About 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one
1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one (PubChem CID 170007907) has the molecular formula C30H28N2O3
and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one.
Molecular Properties
| Compound Name | 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one |
| PubChem CID | 170007907 |
| Molecular Formula | C30H28N2O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one |
| SMILES | O=C1CCN(c2cccc(-c3ccc(OCc4ccccc4)nc3OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C30H28N2O3/c33-27-16-18-32(19-17-27)26-13-7-12-25(20-26)28-14-15-29(34-21-23-8-3-1-4-9-23)31-30(28)35-22-24-10-5-2-6-11-24/h1-15,20H,16-19,21-22H2 |
| InChIKey | GGLLEMBWDBEFTI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one?
The IUPAC name of 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one (CID 170007907) is 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one.
What is the SMILES notation for 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one?
The canonical SMILES for 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one is O=C1CCN(c2cccc(-c3ccc(OCc4ccccc4)nc3OCc3ccccc3)c2)CC1.
What is the InChIKey of 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one?
The InChIKey is GGLLEMBWDBEFTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28N2O3/c33-27-16-18-32(19-17-27)26-13-7-12-25(20-26)28-14-15-29(34-21-23-8-3-1-4-9-23)31-30(28)35-22-24-10-5-2-6-11-24/h1-15,20H,16-19,21-22H2.
What are the key properties of 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one?
1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one has a molecular weight of 464.57 g/mol, XLogP of 6.08, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]piperidin-4-one is sourced from PubChem (CID 170007907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).