C18H36N4O3S — CID 170008444
N-methyl-N-[2-[methyl-[2-[methyl(pentyl)amino]-2-oxoethyl]amino]-2-oxoethyl]-2-[methyl(2-sulfanylpropyl)amino]acetamide (PubChem CID 170008444) has the molecular formula C18H36N4O3S and a molecular weight of 388.58 g/mol. Its IUPAC name is N-methyl-N-[2-[methyl-[2-[methyl(pentyl)amino]-2-oxoethyl]amino]-2-oxoethyl]-2-[methyl(2-sulfanylpropyl)amino]acetamide.
| Compound Name | N-methyl-N-[2-[methyl-[2-[methyl(pentyl)amino]-2-oxoethyl]amino]-2-oxoethyl]-2-[methyl(2-sulfanylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 170008444 |
| Molecular Formula | C18H36N4O3S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-methyl-N-[2-[methyl-[2-[methyl(pentyl)amino]-2-oxoethyl]amino]-2-oxoethyl]-2-[methyl(2-sulfanylpropyl)amino]acetamide |
| SMILES | CCCCCN(C)C(=O)CN(C)C(=O)CN(C)C(=O)CN(C)CC(C)S |
| InChI | InChI=1S/C18H36N4O3S/c1-7-8-9-10-20(4)17(24)13-22(6)18(25)14-21(5)16(23)12-19(3)11-15(2)26/h15,26H,7-14H2,1-6H3 |
| InChIKey | BXHMSMITXHNAFR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|