C56H106O9 — CID 170008877
heptadecan-9-yl 8-[2-[5-[2-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethoxy]ethoxy]pentoxymethyl]-3-(8-oxoundecoxy)propoxy]octanoate (PubChem CID 170008877) has the molecular formula C56H106O9 and a molecular weight of 923.45 g/mol. Its IUPAC name is heptadecan-9-yl 8-[2-[5-[2-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethoxy]ethoxy]pentoxymethyl]-3-(8-oxoundecoxy)propoxy]octanoate.
| Compound Name | heptadecan-9-yl 8-[2-[5-[2-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethoxy]ethoxy]pentoxymethyl]-3-(8-oxoundecoxy)propoxy]octanoate |
|---|---|
| PubChem CID | 170008877 |
| Molecular Formula | C56H106O9 |
| Molecular Weight | 923.45 g/mol |
| Exact Mass | 922.78 |
| IUPAC Name | heptadecan-9-yl 8-[2-[5-[2-[2-[(Z,2E)-2-ethylidenepent-3-enoxy]ethoxy]ethoxy]pentoxymethyl]-3-(8-oxoundecoxy)propoxy]octanoate |
| SMILES | C/C=C\C(=C/C)COCCOCCOCCCCCOCC(COCCCCCCCC(=O)CCC)COCCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C56H106O9/c1-6-11-13-15-20-27-37-55(38-28-21-16-14-12-7-2)65-56(58)39-29-22-18-24-31-42-62-50-53(49-61-41-30-23-17-19-26-36-54(57)35-9-4)51-63-43-33-25-32-40-59-44-45-60-46-47-64-48-52(10-5)34-8-3/h8,10,34,53,55H,6-7,9,11-33,35-51H2,1-5H3/b34-8-,52-10+ |
| InChIKey | CQAHILDLVUXSMM-XIQWQNMZSA-N |
| XLogP | 14.86 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.45 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|