About (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione
(5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione (PubChem CID 170009566) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione |
| PubChem CID | 170009566 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione |
| SMILES | C[C@@H]1C(=O)C(C(C)(C)C)=CC(=O)[C@@H]1O |
| InChI | InChI=1S/C11H16O3/c1-6-9(13)7(11(2,3)4)5-8(12)10(6)14/h5-6,10,14H,1-4H3/t6-,10-/m1/s1 |
| InChIKey | MLGZZWZTMFJIIJ-LHLIQPBNSA-N |
| XLogP | 1.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione?
The IUPAC name of (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione (CID 170009566) is (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione.
What is the SMILES notation for (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione?
The canonical SMILES for (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione is C[C@@H]1C(=O)C(C(C)(C)C)=CC(=O)[C@@H]1O.
What is the InChIKey of (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione?
The InChIKey is MLGZZWZTMFJIIJ-LHLIQPBNSA-N. The full InChI is InChI=1S/C11H16O3/c1-6-9(13)7(11(2,3)4)5-8(12)10(6)14/h5-6,10,14H,1-4H3/t6-,10-/m1/s1.
What are the key properties of (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione?
(5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione has a molecular weight of 196.25 g/mol, XLogP of 1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,6S)-2-tert-butyl-5-hydroxy-6-methylcyclohex-2-ene-1,4-dione is sourced from PubChem (CID 170009566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).