C10H12N4S — CID 170009714
2-[amino-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,3-thiazol-2-yl]amino]acetonitrile (PubChem CID 170009714) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-[amino-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,3-thiazol-2-yl]amino]acetonitrile.
| Compound Name | 2-[amino-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,3-thiazol-2-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 170009714 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-[amino-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1,3-thiazol-2-yl]amino]acetonitrile |
| SMILES | C=C/C=C\c1nc(N(N)CC#N)sc1C |
| InChI | InChI=1S/C10H12N4S/c1-3-4-5-9-8(2)15-10(13-9)14(12)7-6-11/h3-5H,1,7,12H2,2H3/b5-4- |
| InChIKey | BTMSZZACQADYLX-PLNGDYQASA-N |
| XLogP | 1.85 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|