About 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline
4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline (PubChem CID 170009860) has the molecular formula C18H22F2N2O
and a molecular weight of 320.38 g/mol. Its IUPAC name is 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline.
Molecular Properties
| Compound Name | 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline |
| PubChem CID | 170009860 |
| Molecular Formula | C18H22F2N2O |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline |
| SMILES | CCC(C)Oc1ccnc2ccc(N3CCC(F)(F)CC3)cc12 |
| InChI | InChI=1S/C18H22F2N2O/c1-3-13(2)23-17-6-9-21-16-5-4-14(12-15(16)17)22-10-7-18(19,20)8-11-22/h4-6,9,12-13H,3,7-8,10-11H2,1-2H3 |
| InChIKey | GIKPGZQQYPZMHD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline?
The IUPAC name of 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline (CID 170009860) is 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline.
What is the SMILES notation for 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline?
The canonical SMILES for 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline is CCC(C)Oc1ccnc2ccc(N3CCC(F)(F)CC3)cc12.
What is the InChIKey of 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline?
The InChIKey is GIKPGZQQYPZMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2N2O/c1-3-13(2)23-17-6-9-21-16-5-4-14(12-15(16)17)22-10-7-18(19,20)8-11-22/h4-6,9,12-13H,3,7-8,10-11H2,1-2H3.
What are the key properties of 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline?
4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline has a molecular weight of 320.38 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yloxy-6-(4,4-difluoropiperidin-1-yl)quinoline is sourced from PubChem (CID 170009860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).