C17H11F3O4 — CID 170010040
(2S,3R)-2,3-dihydroxy-3-[4-(trifluoromethyl)phenyl]-2H-naphthalene-1,4-dione (PubChem CID 170010040) has the molecular formula C17H11F3O4 and a molecular weight of 336.27 g/mol. Its IUPAC name is (2S,3R)-2,3-dihydroxy-3-[4-(trifluoromethyl)phenyl]-2H-naphthalene-1,4-dione.
| Compound Name | (2S,3R)-2,3-dihydroxy-3-[4-(trifluoromethyl)phenyl]-2H-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 170010040 |
| Molecular Formula | C17H11F3O4 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | (2S,3R)-2,3-dihydroxy-3-[4-(trifluoromethyl)phenyl]-2H-naphthalene-1,4-dione |
| SMILES | O=C1c2ccccc2C(=O)[C@@](O)(c2ccc(C(F)(F)F)cc2)[C@@H]1O |
| InChI | InChI=1S/C17H11F3O4/c18-17(19,20)10-7-5-9(6-8-10)16(24)14(22)12-4-2-1-3-11(12)13(21)15(16)23/h1-8,15,23-24H/t15-,16+/m1/s1 |
| InChIKey | XQFSJTZVUFXMHH-CVEARBPZSA-N |
| XLogP | 2.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|