About (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine
(5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine (PubChem CID 170010167) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine.
Molecular Properties
| Compound Name | (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine |
| PubChem CID | 170010167 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine |
| SMILES | C#C/C=C1/C=NCN[C@H]1C(C)C |
| InChI | InChI=1S/C10H14N2/c1-4-5-9-6-11-7-12-10(9)8(2)3/h1,5-6,8,10,12H,7H2,2-3H3/b9-5-/t10-/m0/s1 |
| InChIKey | TWJJNMQKPGFEFO-BSKOKIOFSA-N |
| XLogP | 1.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine?
The IUPAC name of (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine (CID 170010167) is (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine.
What is the SMILES notation for (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine?
The canonical SMILES for (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine is C#C/C=C1/C=NCN[C@H]1C(C)C.
What is the InChIKey of (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine?
The InChIKey is TWJJNMQKPGFEFO-BSKOKIOFSA-N. The full InChI is InChI=1S/C10H14N2/c1-4-5-9-6-11-7-12-10(9)8(2)3/h1,5-6,8,10,12H,7H2,2-3H3/b9-5-/t10-/m0/s1.
What are the key properties of (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine?
(5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine has a molecular weight of 162.24 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,6S)-6-propan-2-yl-5-prop-2-ynylidene-2,6-dihydro-1H-pyrimidine is sourced from PubChem (CID 170010167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).