C20H36N2 — CID 170010170
(3E,5Z)-3-methyl-N-propyl-4-(3,4,4-trimethylpiperidin-3-yl)octa-3,5,7-trien-2-amine (PubChem CID 170010170) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is (3E,5Z)-3-methyl-N-propyl-4-(3,4,4-trimethylpiperidin-3-yl)octa-3,5,7-trien-2-amine.
| Compound Name | (3E,5Z)-3-methyl-N-propyl-4-(3,4,4-trimethylpiperidin-3-yl)octa-3,5,7-trien-2-amine |
|---|---|
| PubChem CID | 170010170 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | (3E,5Z)-3-methyl-N-propyl-4-(3,4,4-trimethylpiperidin-3-yl)octa-3,5,7-trien-2-amine |
| SMILES | C=C/C=C\C(=C(\C)C(C)NCCC)C1(C)CNCCC1(C)C |
| InChI | InChI=1S/C20H36N2/c1-8-10-11-18(16(3)17(4)22-13-9-2)20(7)15-21-14-12-19(20,5)6/h8,10-11,17,21-22H,1,9,12-15H2,2-7H3/b11-10-,18-16+ |
| InChIKey | JJDOQXYMBUZBQJ-JARQXYAPSA-N |
| XLogP | 4.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|