C19H27NO2S — CID 170010624
(3E,5Z)-N-[(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]octa-1,3,5,7-tetraene-4-sulfonamide (PubChem CID 170010624) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is (3E,5Z)-N-[(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]octa-1,3,5,7-tetraene-4-sulfonamide.
| Compound Name | (3E,5Z)-N-[(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]octa-1,3,5,7-tetraene-4-sulfonamide |
|---|---|
| PubChem CID | 170010624 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (3E,5Z)-N-[(4E)-3-methyl-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]octa-1,3,5,7-tetraene-4-sulfonamide |
| SMILES | C=C/C=C\C(=C/C=C)S(=O)(=O)NC(C)(CC)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C19H27NO2S/c1-7-12-16-18(15-10-4)23(21,22)20-19(6,11-5)17(13-8-2)14-9-3/h7-10,12-16,20H,1-2,4,11H2,3,5-6H3/b14-9-,16-12-,17-13+,18-15+ |
| InChIKey | HHSIYEAPBZQQJC-LLMPVGFKSA-N |
| XLogP | 4.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|