About 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane
11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane (PubChem CID 170010764) has the molecular formula C26H42O5
and a molecular weight of 434.62 g/mol. Its IUPAC name is 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane.
Molecular Properties
| Compound Name | 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane |
| PubChem CID | 170010764 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane |
| SMILES | COCCOCCOc1c(C)cc(C)cc1C1OC2CCCCCCCC(CCC2)O1 |
| InChI | InChI=1S/C26H42O5/c1-20-18-21(2)25(29-17-16-28-15-14-27-3)24(19-20)26-30-22-10-7-5-4-6-8-11-23(31-26)13-9-12-22/h18-19,22-23,26H,4-17H2,1-3H3 |
| InChIKey | PAWVALVGVZLYHM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane?
The IUPAC name of 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane (CID 170010764) is 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane.
What is the SMILES notation for 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane?
The canonical SMILES for 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane is COCCOCCOc1c(C)cc(C)cc1C1OC2CCCCCCCC(CCC2)O1.
What is the InChIKey of 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane?
The InChIKey is PAWVALVGVZLYHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42O5/c1-20-18-21(2)25(29-17-16-28-15-14-27-3)24(19-20)26-30-22-10-7-5-4-6-8-11-23(31-26)13-9-12-22/h18-19,22-23,26H,4-17H2,1-3H3.
What are the key properties of 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane?
11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane has a molecular weight of 434.62 g/mol, XLogP of 6.04, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 11-[2-[2-(2-methoxyethoxy)ethoxy]-3,5-dimethylphenyl]-10,12-dioxabicyclo[7.3.3]pentadecane is sourced from PubChem (CID 170010764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).