About 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole
6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole (PubChem CID 170011367) has the molecular formula C23H31N3
and a molecular weight of 349.52 g/mol. Its IUPAC name is 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole |
| PubChem CID | 170011367 |
| Molecular Formula | C23H31N3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole |
| SMILES | Cc1cc(N2Cc3cc(C(C)(C)C)cc([C@@H]4CCCN4)c3C2)cc(C)n1 |
| InChI | InChI=1S/C23H31N3/c1-15-9-19(10-16(2)25-15)26-13-17-11-18(23(3,4)5)12-20(21(17)14-26)22-7-6-8-24-22/h9-12,22,24H,6-8,13-14H2,1-5H3/t22-/m0/s1 |
| InChIKey | TVOOUAMTMXVOFM-QFIPXVFZSA-N |
| XLogP | 4.94 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole?
The IUPAC name of 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole (CID 170011367) is 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole.
What is the SMILES notation for 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole?
The canonical SMILES for 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole is Cc1cc(N2Cc3cc(C(C)(C)C)cc([C@@H]4CCCN4)c3C2)cc(C)n1.
What is the InChIKey of 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole?
The InChIKey is TVOOUAMTMXVOFM-QFIPXVFZSA-N. The full InChI is InChI=1S/C23H31N3/c1-15-9-19(10-16(2)25-15)26-13-17-11-18(23(3,4)5)12-20(21(17)14-26)22-7-6-8-24-22/h9-12,22,24H,6-8,13-14H2,1-5H3/t22-/m0/s1.
What are the key properties of 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole?
6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole has a molecular weight of 349.52 g/mol, XLogP of 4.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-(2,6-dimethyl-4-pyridinyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-dihydroisoindole is sourced from PubChem (CID 170011367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).