C29H34FN5O4 — CID 170011512
4-[[4-[(4-butylpiperazin-1-yl)methyl]-2-fluorophenyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 170011512) has the molecular formula C29H34FN5O4 and a molecular weight of 535.62 g/mol. Its IUPAC name is 4-[[4-[(4-butylpiperazin-1-yl)methyl]-2-fluorophenyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[4-[(4-butylpiperazin-1-yl)methyl]-2-fluorophenyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 170011512 |
| Molecular Formula | C29H34FN5O4 |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 4-[[4-[(4-butylpiperazin-1-yl)methyl]-2-fluorophenyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CCCCN1CCN(Cc2ccc(CNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)c(F)c2)CC1 |
| InChI | InChI=1S/C29H34FN5O4/c1-2-3-11-33-12-14-34(15-13-33)18-19-7-8-20(22(30)16-19)17-31-23-6-4-5-21-26(23)29(39)35(28(21)38)24-9-10-25(36)32-27(24)37/h4-8,16,24,31H,2-3,9-15,17-18H2,1H3,(H,32,36,37) |
| InChIKey | RFVJPTSTUPAXSU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|