C22H22FN6+ — CID 170011836
[7-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-1,8-naphthyridin-3-yl]-methyl-(pyrrolidin-3-ylmethylidene)azanium (PubChem CID 170011836) has the molecular formula C22H22FN6+ and a molecular weight of 389.46 g/mol. Its IUPAC name is [7-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-1,8-naphthyridin-3-yl]-methyl-(pyrrolidin-3-ylmethylidene)azanium.
| Compound Name | [7-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-1,8-naphthyridin-3-yl]-methyl-(pyrrolidin-3-ylmethylidene)azanium |
|---|---|
| PubChem CID | 170011836 |
| Molecular Formula | C22H22FN6+ |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | [7-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-1,8-naphthyridin-3-yl]-methyl-(pyrrolidin-3-ylmethylidene)azanium |
| SMILES | Cc1cn2cc(-c3ccc4cc(/[N+](C)=C/C5CCNC5)cnc4n3)cc(F)c2n1 |
| InChI | InChI=1S/C22H22FN6/c1-14-11-29-13-17(8-19(23)22(29)26-14)20-4-3-16-7-18(10-25-21(16)27-20)28(2)12-15-5-6-24-9-15/h3-4,7-8,10-13,15,24H,5-6,9H2,1-2H3/q+1/b28-12+ |
| InChIKey | UJYBFFBWWFVZOL-KVSWJAHQSA-N |
| XLogP | 3.35 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|