About 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine
7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 170012027) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine |
| PubChem CID | 170012027 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | COc1c[nH]c2ncc(C)nc12 |
| InChI | InChI=1S/C8H9N3O/c1-5-3-9-8-7(11-5)6(12-2)4-10-8/h3-4H,1-2H3,(H,9,10) |
| InChIKey | VLHZBPAZONKTAW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine?
The IUPAC name of 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine (CID 170012027) is 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine is COc1c[nH]c2ncc(C)nc12.
What is the InChIKey of 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine?
The InChIKey is VLHZBPAZONKTAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5-3-9-8-7(11-5)6(12-2)4-10-8/h3-4H,1-2H3,(H,9,10).
What are the key properties of 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine?
7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine has a molecular weight of 163.18 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2-methyl-5H-pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 170012027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).