About 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile
3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile (PubChem CID 170012293) has the molecular formula C19H25N5O5
and a molecular weight of 403.44 g/mol. Its IUPAC name is 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile.
Molecular Properties
| Compound Name | 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile |
| PubChem CID | 170012293 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile |
| SMILES | N#CCCOCC(OCCC#N)C(OCCC#N)C(COCC#N)OCCC#N |
| InChI | InChI=1S/C19H25N5O5/c20-5-1-10-25-15-17(27-11-2-6-21)19(29-13-4-8-23)18(16-26-14-9-24)28-12-3-7-22/h17-19H,1-4,10-16H2 |
| InChIKey | BHTJCUUKXGMINJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 165.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile?
The IUPAC name of 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile (CID 170012293) is 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile.
What is the SMILES notation for 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile?
The canonical SMILES for 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile is N#CCCOCC(OCCC#N)C(OCCC#N)C(COCC#N)OCCC#N.
What is the InChIKey of 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile?
The InChIKey is BHTJCUUKXGMINJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5O5/c20-5-1-10-25-15-17(27-11-2-6-21)19(29-13-4-8-23)18(16-26-14-9-24)28-12-3-7-22/h17-19H,1-4,10-16H2.
What are the key properties of 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile?
3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile has a molecular weight of 403.44 g/mol, XLogP of 1.35, 18 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3,4-tris(2-cyanoethoxy)-5-(cyanomethoxy)pentoxy]propanenitrile is sourced from PubChem (CID 170012293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).