C17H18O5S — CID 170012568
2-(3,4-dimethylphenoxy)carbonyl-4,5-dimethylbenzenesulfonic acid (PubChem CID 170012568) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)carbonyl-4,5-dimethylbenzenesulfonic acid.
| Compound Name | 2-(3,4-dimethylphenoxy)carbonyl-4,5-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 170012568 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)carbonyl-4,5-dimethylbenzenesulfonic acid |
| SMILES | Cc1ccc(OC(=O)c2cc(C)c(C)cc2S(=O)(=O)O)cc1C |
| InChI | InChI=1S/C17H18O5S/c1-10-5-6-14(7-11(10)2)22-17(18)15-8-12(3)13(4)9-16(15)23(19,20)21/h5-9H,1-4H3,(H,19,20,21) |
| InChIKey | WINXPEBNDRIZHA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|