C24H32F3N5O4 — CID 170013064
N-[(1S,3S,6S,7S,12S,16Z,18S)-3-cyano-7,13,13-trimethyl-5,11,20-trioxo-4,10,19-triazatricyclo[16.2.1.06,10]henicos-16-en-12-yl]-2,2,2-trifluoroacetamide (PubChem CID 170013064) has the molecular formula C24H32F3N5O4 and a molecular weight of 511.55 g/mol. Its IUPAC name is N-[(1S,3S,6S,7S,12S,16Z,18S)-3-cyano-7,13,13-trimethyl-5,11,20-trioxo-4,10,19-triazatricyclo[16.2.1.06,10]henicos-16-en-12-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S,3S,6S,7S,12S,16Z,18S)-3-cyano-7,13,13-trimethyl-5,11,20-trioxo-4,10,19-triazatricyclo[16.2.1.06,10]henicos-16-en-12-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170013064 |
| Molecular Formula | C24H32F3N5O4 |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | N-[(1S,3S,6S,7S,12S,16Z,18S)-3-cyano-7,13,13-trimethyl-5,11,20-trioxo-4,10,19-triazatricyclo[16.2.1.06,10]henicos-16-en-12-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H]1CCN2C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)CC/C=C\[C@@H]3C[C@@H](C[C@@H](C#N)NC(=O)[C@H]12)C(=O)N3 |
| InChI | InChI=1S/C24H32F3N5O4/c1-13-7-9-32-17(13)20(34)30-16(12-28)11-14-10-15(29-19(14)33)6-4-5-8-23(2,3)18(21(32)35)31-22(36)24(25,26)27/h4,6,13-18H,5,7-11H2,1-3H3,(H,29,33)(H,30,34)(H,31,36)/b6-4-/t13-,14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | YUUDNQLIHDRNLI-VQBLHYEYSA-N |
| XLogP | 1.55 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|