About 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine
1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine (PubChem CID 170013093) has the molecular formula C14H27N3
and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine |
| PubChem CID | 170013093 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine |
| SMILES | C=CC(=C)N1CCN(C(C)C)C(CN(C)C)C1 |
| InChI | InChI=1S/C14H27N3/c1-7-13(4)16-8-9-17(12(2)3)14(11-16)10-15(5)6/h7,12,14H,1,4,8-11H2,2-3,5-6H3 |
| InChIKey | BNGHHFXYSUMZKL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine (CID 170013093) is 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine is C=CC(=C)N1CCN(C(C)C)C(CN(C)C)C1.
What is the InChIKey of 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine?
The InChIKey is BNGHHFXYSUMZKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3/c1-7-13(4)16-8-9-17(12(2)3)14(11-16)10-15(5)6/h7,12,14H,1,4,8-11H2,2-3,5-6H3.
What are the key properties of 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine?
1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine has a molecular weight of 237.39 g/mol, XLogP of 1.64, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-buta-1,3-dien-2-yl-1-propan-2-ylpiperazin-2-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 170013093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).