About 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine
6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine (PubChem CID 170013190) has the molecular formula C9H10F3N3OS
and a molecular weight of 265.26 g/mol. Its IUPAC name is 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine |
| PubChem CID | 170013190 |
| Molecular Formula | C9H10F3N3OS |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine |
| SMILES | Nc1cnc(S2(=O)=NCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3N3OS/c10-9(11,12)7-4-6(13)5-14-8(7)17(16)3-1-2-15-17/h4-5H,1-3,13H2 |
| InChIKey | ZXKDWLJEIMVLKQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine?
The IUPAC name of 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine (CID 170013190) is 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine.
What is the SMILES notation for 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine?
The canonical SMILES for 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine is Nc1cnc(S2(=O)=NCCC2)c(C(F)(F)F)c1.
What is the InChIKey of 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine?
The InChIKey is ZXKDWLJEIMVLKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3N3OS/c10-9(11,12)7-4-6(13)5-14-8(7)17(16)3-1-2-15-17/h4-5H,1-3,13H2.
What are the key properties of 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine?
6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine has a molecular weight of 265.26 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-oxo-4,5-dihydro-3H-1,2-thiazol-1-yl)-5-(trifluoromethyl)pyridin-3-amine is sourced from PubChem (CID 170013190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).