C18H27NO5S — CID 170014065
methyl 4-(3-hydroxy-2,3-dimethylbutan-2-yl)oxysulfanyl-2-morpholin-4-ylbenzoate (PubChem CID 170014065) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is methyl 4-(3-hydroxy-2,3-dimethylbutan-2-yl)oxysulfanyl-2-morpholin-4-ylbenzoate.
| Compound Name | methyl 4-(3-hydroxy-2,3-dimethylbutan-2-yl)oxysulfanyl-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 170014065 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | methyl 4-(3-hydroxy-2,3-dimethylbutan-2-yl)oxysulfanyl-2-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1ccc(SOC(C)(C)C(C)(C)O)cc1N1CCOCC1 |
| InChI | InChI=1S/C18H27NO5S/c1-17(2,21)18(3,4)24-25-13-6-7-14(16(20)22-5)15(12-13)19-8-10-23-11-9-19/h6-7,12,21H,8-11H2,1-5H3 |
| InChIKey | XKGFOFGSPVCENY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|