About N-methyl-10b,10c-dihydropyren-1-amine
N-methyl-10b,10c-dihydropyren-1-amine (PubChem CID 170014525) has the molecular formula C17H15N
and a molecular weight of 233.31 g/mol. Its IUPAC name is N-methyl-10b,10c-dihydropyren-1-amine.
Molecular Properties
| Compound Name | N-methyl-10b,10c-dihydropyren-1-amine |
| PubChem CID | 170014525 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-methyl-10b,10c-dihydropyren-1-amine |
| SMILES | CNC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2C34 |
| InChI | InChI=1S/C17H15N/c1-18-15-10-8-13-6-5-11-3-2-4-12-7-9-14(15)17(13)16(11)12/h2-10,16-18H,1H3 |
| InChIKey | ITQGDQUUWYTKBC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-10b,10c-dihydropyren-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-10b,10c-dihydropyren-1-amine?
The IUPAC name of N-methyl-10b,10c-dihydropyren-1-amine (CID 170014525) is N-methyl-10b,10c-dihydropyren-1-amine.
What is the SMILES notation for N-methyl-10b,10c-dihydropyren-1-amine?
The canonical SMILES for N-methyl-10b,10c-dihydropyren-1-amine is CNC1=C2C=CC3=CC=CC4=CC=C(C=C1)C2C34.
What is the InChIKey of N-methyl-10b,10c-dihydropyren-1-amine?
The InChIKey is ITQGDQUUWYTKBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N/c1-18-15-10-8-13-6-5-11-3-2-4-12-7-9-14(15)17(13)16(11)12/h2-10,16-18H,1H3.
What are the key properties of N-methyl-10b,10c-dihydropyren-1-amine?
N-methyl-10b,10c-dihydropyren-1-amine has a molecular weight of 233.31 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-10b,10c-dihydropyren-1-amine is sourced from PubChem (CID 170014525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).