About 1-fluoro-2-iodo-10b,10c-dihydropyrene
1-fluoro-2-iodo-10b,10c-dihydropyrene (PubChem CID 170014548) has the molecular formula C16H10FI
and a molecular weight of 348.16 g/mol. Its IUPAC name is 1-fluoro-2-iodo-10b,10c-dihydropyrene.
Molecular Properties
| Compound Name | 1-fluoro-2-iodo-10b,10c-dihydropyrene |
| PubChem CID | 170014548 |
| Molecular Formula | C16H10FI |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 1-fluoro-2-iodo-10b,10c-dihydropyrene |
| SMILES | FC1=C2C=CC3=CC=CC4=CC=C(C=C1I)C2C34 |
| InChI | InChI=1S/C16H10FI/c17-16-12-7-6-10-3-1-2-9-4-5-11(8-13(16)18)15(12)14(9)10/h1-8,14-15H |
| InChIKey | SCYDDLIDWAAPLG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-iodo-10b,10c-dihydropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-iodo-10b,10c-dihydropyrene?
The IUPAC name of 1-fluoro-2-iodo-10b,10c-dihydropyrene (CID 170014548) is 1-fluoro-2-iodo-10b,10c-dihydropyrene.
What is the SMILES notation for 1-fluoro-2-iodo-10b,10c-dihydropyrene?
The canonical SMILES for 1-fluoro-2-iodo-10b,10c-dihydropyrene is FC1=C2C=CC3=CC=CC4=CC=C(C=C1I)C2C34.
What is the InChIKey of 1-fluoro-2-iodo-10b,10c-dihydropyrene?
The InChIKey is SCYDDLIDWAAPLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FI/c17-16-12-7-6-10-3-1-2-9-4-5-11(8-13(16)18)15(12)14(9)10/h1-8,14-15H.
What are the key properties of 1-fluoro-2-iodo-10b,10c-dihydropyrene?
1-fluoro-2-iodo-10b,10c-dihydropyrene has a molecular weight of 348.16 g/mol, XLogP of 4.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-iodo-10b,10c-dihydropyrene is sourced from PubChem (CID 170014548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).