C50H83NO5 — CID 170015695
[(Z)-18-[3-[2-(2-hydroxyethyl)piperidin-1-yl]propanoyloxy]octadec-9-en-7-yl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 170015695) has the molecular formula C50H83NO5 and a molecular weight of 778.22 g/mol. Its IUPAC name is [(Z)-18-[3-[2-(2-hydroxyethyl)piperidin-1-yl]propanoyloxy]octadec-9-en-7-yl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(Z)-18-[3-[2-(2-hydroxyethyl)piperidin-1-yl]propanoyloxy]octadec-9-en-7-yl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 170015695 |
| Molecular Formula | C50H83NO5 |
| Molecular Weight | 778.22 g/mol |
| Exact Mass | 777.63 |
| IUPAC Name | [(Z)-18-[3-[2-(2-hydroxyethyl)piperidin-1-yl]propanoyloxy]octadec-9-en-7-yl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(C/C=C\CCCCCCCCOC(=O)CCN1CCCCC1CCO)CCCCCC |
| InChI | InChI=1S/C50H83NO5/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-23-26-29-33-40-50(54)56-48(38-31-8-6-4-2)39-32-28-25-22-21-24-27-30-36-46-55-49(53)41-44-51-43-35-34-37-47(51)42-45-52/h5,7,10-11,13-14,16-17,19-20,26,28-29,32,47-48,52H,3-4,6,8-9,12,15,18,21-25,27,30-31,33-46H2,1-2H3/b7-5-,11-10-,14-13-,17-16-,20-19-,29-26-,32-28- |
| InChIKey | DSBPAIYZYJSQSW-ASHIEEMVSA-N |
| XLogP | 13.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.22 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|