C45H46N2O5 — CID 170015708
4-[4-[10-methoxy-5-(4-methoxyphenyl)-18,21,21-trimethyl-11-morpholin-4-yl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]morpholine (PubChem CID 170015708) has the molecular formula C45H46N2O5 and a molecular weight of 694.87 g/mol. Its IUPAC name is 4-[4-[10-methoxy-5-(4-methoxyphenyl)-18,21,21-trimethyl-11-morpholin-4-yl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]morpholine.
| Compound Name | 4-[4-[10-methoxy-5-(4-methoxyphenyl)-18,21,21-trimethyl-11-morpholin-4-yl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 170015708 |
| Molecular Formula | C45H46N2O5 |
| Molecular Weight | 694.87 g/mol |
| Exact Mass | 694.34 |
| IUPAC Name | 4-[4-[10-methoxy-5-(4-methoxyphenyl)-18,21,21-trimethyl-11-morpholin-4-yl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
| SMILES | COc1ccc(C2(c3ccc(N4CCOCC4)cc3)C=Cc3c4c(c5cc(N6CCOCC6)c(OC)cc5c3O2)-c2ccc(C)cc2C4(C)C)cc1 |
| InChI | InChI=1S/C45H46N2O5/c1-29-6-15-34-38(26-29)44(2,3)42-35-16-17-45(31-9-13-33(48-4)14-10-31,30-7-11-32(12-8-30)46-18-22-50-23-19-46)52-43(35)37-28-40(49-5)39(27-36(37)41(34)42)47-20-24-51-25-21-47/h6-17,26-28H,18-25H2,1-5H3 |
| InChIKey | KLDPEBFSZKRUIC-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.87 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|