C9H13ClO3P+ — CID 170016136
(4R)-4-[(2E,4E)-4-chlorohexa-2,4-dien-2-yl]-1,3,2-dioxaphosphinan-2-ium 2-oxide (PubChem CID 170016136) has the molecular formula C9H13ClO3P+ and a molecular weight of 235.63 g/mol. Its IUPAC name is (4R)-4-[(2E,4E)-4-chlorohexa-2,4-dien-2-yl]-1,3,2-dioxaphosphinan-2-ium 2-oxide.
| Compound Name | (4R)-4-[(2E,4E)-4-chlorohexa-2,4-dien-2-yl]-1,3,2-dioxaphosphinan-2-ium 2-oxide |
|---|---|
| PubChem CID | 170016136 |
| Molecular Formula | C9H13ClO3P+ |
| Molecular Weight | 235.63 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | (4R)-4-[(2E,4E)-4-chlorohexa-2,4-dien-2-yl]-1,3,2-dioxaphosphinan-2-ium 2-oxide |
| SMILES | C/C=C(Cl)\C=C(/C)[C@H]1CCO[P+](=O)O1 |
| InChI | InChI=1S/C9H13ClO3P/c1-3-8(10)6-7(2)9-4-5-12-14(11)13-9/h3,6,9H,4-5H2,1-2H3/q+1/b7-6+,8-3+/t9-/m1/s1 |
| InChIKey | DWKOKNREQIDQLJ-JMYFJEIGSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|