About 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine
4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine (PubChem CID 170016407) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine |
| PubChem CID | 170016407 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine |
| SMILES | CCOC1CN(C)C(C)C1OC |
| InChI | InChI=1S/C9H19NO2/c1-5-12-8-6-10(3)7(2)9(8)11-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | TZWFZDGVYNPIJY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine?
The IUPAC name of 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine (CID 170016407) is 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine.
What is the SMILES notation for 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine?
The canonical SMILES for 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine is CCOC1CN(C)C(C)C1OC.
What is the InChIKey of 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine?
The InChIKey is TZWFZDGVYNPIJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-5-12-8-6-10(3)7(2)9(8)11-4/h7-9H,5-6H2,1-4H3.
What are the key properties of 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine?
4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine has a molecular weight of 173.26 g/mol, XLogP of 0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-3-methoxy-1,2-dimethylpyrrolidine is sourced from PubChem (CID 170016407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).