About (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide
(2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide (PubChem CID 170016550) has the molecular formula C9H15ClF3NO2
and a molecular weight of 261.67 g/mol. Its IUPAC name is (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide.
Molecular Properties
| Compound Name | (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide |
| PubChem CID | 170016550 |
| Molecular Formula | C9H15ClF3NO2 |
| Molecular Weight | 261.67 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide |
| SMILES | CCCCN(Cl)C(=O)[C@](C)(OC)C(F)(F)F |
| InChI | InChI=1S/C9H15ClF3NO2/c1-4-5-6-14(10)7(15)8(2,16-3)9(11,12)13/h4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | XMXNSHOAZCPARG-QMMMGPOBSA-N |
| XLogP | 2.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide?
The IUPAC name of (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide (CID 170016550) is (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide.
What is the SMILES notation for (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide?
The canonical SMILES for (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide is CCCCN(Cl)C(=O)[C@](C)(OC)C(F)(F)F.
What is the InChIKey of (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide?
The InChIKey is XMXNSHOAZCPARG-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H15ClF3NO2/c1-4-5-6-14(10)7(15)8(2,16-3)9(11,12)13/h4-6H2,1-3H3/t8-/m0/s1.
What are the key properties of (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide?
(2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide has a molecular weight of 261.67 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-butyl-N-chloro-3,3,3-trifluoro-2-methoxy-2-methylpropanamide is sourced from PubChem (CID 170016550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).