About amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol
amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol (PubChem CID 170016631) has the molecular formula C8H15F3N2OS
and a molecular weight of 244.28 g/mol. Its IUPAC name is amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol.
Molecular Properties
| Compound Name | amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol |
| PubChem CID | 170016631 |
| Molecular Formula | C8H15F3N2OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol |
| SMILES | C[C@@H]1CC[C@@H](SC(F)(F)F)N(C(N)O)C1 |
| InChI | InChI=1S/C8H15F3N2OS/c1-5-2-3-6(15-8(9,10)11)13(4-5)7(12)14/h5-7,14H,2-4,12H2,1H3/t5-,6-,7?/m1/s1 |
| InChIKey | RBWKDMQSORFOHZ-CQMSUOBXSA-N |
| XLogP | 1.53 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol?
The IUPAC name of amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol (CID 170016631) is amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol.
What is the SMILES notation for amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol?
The canonical SMILES for amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol is C[C@@H]1CC[C@@H](SC(F)(F)F)N(C(N)O)C1.
What is the InChIKey of amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol?
The InChIKey is RBWKDMQSORFOHZ-CQMSUOBXSA-N. The full InChI is InChI=1S/C8H15F3N2OS/c1-5-2-3-6(15-8(9,10)11)13(4-5)7(12)14/h5-7,14H,2-4,12H2,1H3/t5-,6-,7?/m1/s1.
What are the key properties of amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol?
amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol has a molecular weight of 244.28 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino-[(2R,5R)-5-methyl-2-(trifluoromethylsulfanyl)piperidin-1-yl]methanol is sourced from PubChem (CID 170016631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).