About N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide
N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide (PubChem CID 170016760) has the molecular formula C13H21ClN2O2S
and a molecular weight of 304.84 g/mol. Its IUPAC name is N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide.
Molecular Properties
| Compound Name | N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide |
| PubChem CID | 170016760 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide |
| SMILES | C=C/C(Cl)=C\C(=C)CN(NS(=O)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C13H21ClN2O2S/c1-7-12(14)8-10(2)9-16(11(3)17)15-19(18)13(4,5)6/h7-8,15H,1-2,9H2,3-6H3/b12-8+ |
| InChIKey | GYHAQYLKTKNPPX-XYOKQWHBSA-N |
| XLogP | 2.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide?
The IUPAC name of N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide (CID 170016760) is N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide.
What is the SMILES notation for N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide?
The canonical SMILES for N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide is C=C/C(Cl)=C\C(=C)CN(NS(=O)C(C)(C)C)C(C)=O.
What is the InChIKey of N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide?
The InChIKey is GYHAQYLKTKNPPX-XYOKQWHBSA-N. The full InChI is InChI=1S/C13H21ClN2O2S/c1-7-12(14)8-10(2)9-16(11(3)17)15-19(18)13(4,5)6/h7-8,15H,1-2,9H2,3-6H3/b12-8+.
What are the key properties of N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide?
N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide has a molecular weight of 304.84 g/mol, XLogP of 2.67, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butylsulfinyl-N-[(3E)-4-chloro-2-methylidenehexa-3,5-dienyl]acetohydrazide is sourced from PubChem (CID 170016760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).