C50H44N4 — CID 170017211
5-[4-[4-(9,9-dimethylfluoren-3-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-7,7,10,10-tetramethyl-8,9-dihydrobenzo[b]carbazole (PubChem CID 170017211) has the molecular formula C50H44N4 and a molecular weight of 700.93 g/mol. Its IUPAC name is 5-[4-[4-(9,9-dimethylfluoren-3-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-7,7,10,10-tetramethyl-8,9-dihydrobenzo[b]carbazole.
| Compound Name | 5-[4-[4-(9,9-dimethylfluoren-3-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-7,7,10,10-tetramethyl-8,9-dihydrobenzo[b]carbazole |
|---|---|
| PubChem CID | 170017211 |
| Molecular Formula | C50H44N4 |
| Molecular Weight | 700.93 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | 5-[4-[4-(9,9-dimethylfluoren-3-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-7,7,10,10-tetramethyl-8,9-dihydrobenzo[b]carbazole |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)c1ccccc1n3-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)-c3ccccc3C4(C)C)n2)cc1 |
| InChI | InChI=1S/C50H44N4/c1-48(2)26-27-49(3,4)42-30-44-38(29-41(42)48)36-17-11-13-19-43(36)54(44)34-23-20-32(21-24-34)46-51-45(31-14-8-7-9-15-31)52-47(53-46)33-22-25-40-37(28-33)35-16-10-12-18-39(35)50(40,5)6/h7-25,28-30H,26-27H2,1-6H3 |
| InChIKey | ONTSYKASWXKXBE-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.93 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |