C10H11F2NO — CID 170017589
(NE)-N-[2-(2,6-difluorophenyl)-2-methylpropylidene]hydroxylamine (PubChem CID 170017589) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is (NE)-N-[2-(2,6-difluorophenyl)-2-methylpropylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-(2,6-difluorophenyl)-2-methylpropylidene]hydroxylamine |
|---|---|
| PubChem CID | 170017589 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (NE)-N-[2-(2,6-difluorophenyl)-2-methylpropylidene]hydroxylamine |
| SMILES | CC(C)(/C=N/O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H11F2NO/c1-10(2,6-13-14)9-7(11)4-3-5-8(9)12/h3-6,14H,1-2H3/b13-6+ |
| InChIKey | BLAWBNGEIFMFQK-AWNIVKPZSA-N |
| XLogP | 2.70 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|