C12H15N3 — CID 170017695
5,13-dimethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene (PubChem CID 170017695) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 5,13-dimethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene.
| Compound Name | 5,13-dimethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene |
|---|---|
| PubChem CID | 170017695 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 5,13-dimethyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene |
| SMILES | Cc1ccnc2[nH]c3c(c12)CCN(C)C3 |
| InChI | InChI=1S/C12H15N3/c1-8-3-5-13-12-11(8)9-4-6-15(2)7-10(9)14-12/h3,5H,4,6-7H2,1-2H3,(H,13,14) |
| InChIKey | DBIOPJJRVXNYPM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |