C8H10O9S2 — CID 170017775
4-(2,2-dioxooxathiolan-4-yl)-8-oxo-1,3,7,9-tetraoxa-8λ4-thiaspiro[4.5]decan-2-one (PubChem CID 170017775) has the molecular formula C8H10O9S2 and a molecular weight of 314.29 g/mol. Its IUPAC name is 4-(2,2-dioxooxathiolan-4-yl)-8-oxo-1,3,7,9-tetraoxa-8λ4-thiaspiro[4.5]decan-2-one.
| Compound Name | 4-(2,2-dioxooxathiolan-4-yl)-8-oxo-1,3,7,9-tetraoxa-8λ4-thiaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 170017775 |
| Molecular Formula | C8H10O9S2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 4-(2,2-dioxooxathiolan-4-yl)-8-oxo-1,3,7,9-tetraoxa-8λ4-thiaspiro[4.5]decan-2-one |
| SMILES | O=C1OC(C2COS(=O)(=O)C2)C2(COS(=O)OC2)O1 |
| InChI | InChI=1S/C8H10O9S2/c9-7-16-6(5-1-15-19(11,12)2-5)8(17-7)3-13-18(10)14-4-8/h5-6H,1-4H2 |
| InChIKey | QKLATDZXXWMSSP-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|