C36H36Cl2FN3O6 — CID 170017777
4-[3-[2,6-dichloro-4-[(1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl]benzoyl]-2,4-dihydro-1,3-benzoxazin-8-yl]-5-fluoro-2-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)benzoic acid (PubChem CID 170017777) has the molecular formula C36H36Cl2FN3O6 and a molecular weight of 696.60 g/mol. Its IUPAC name is 4-[3-[2,6-dichloro-4-[(1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl]benzoyl]-2,4-dihydro-1,3-benzoxazin-8-yl]-5-fluoro-2-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)benzoic acid.
| Compound Name | 4-[3-[2,6-dichloro-4-[(1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl]benzoyl]-2,4-dihydro-1,3-benzoxazin-8-yl]-5-fluoro-2-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)benzoic acid |
|---|---|
| PubChem CID | 170017777 |
| Molecular Formula | C36H36Cl2FN3O6 |
| Molecular Weight | 696.60 g/mol |
| Exact Mass | 695.20 |
| IUPAC Name | 4-[3-[2,6-dichloro-4-[(1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl]benzoyl]-2,4-dihydro-1,3-benzoxazin-8-yl]-5-fluoro-2-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)benzoic acid |
| SMILES | COC1C[C@H]2CC[C@@H](C1)N2c1cc(Cl)c(C(=O)N2COc3c(cccc3-c3cc(N4C5CCC4COC5)c(C(=O)O)cc3F)C2)c(Cl)c1 |
| InChI | InChI=1S/C36H36Cl2FN3O6/c1-46-25-9-20-5-6-21(10-25)41(20)24-11-29(37)33(30(38)12-24)35(43)40-15-19-3-2-4-26(34(19)48-18-40)27-14-32(28(36(44)45)13-31(27)39)42-22-7-8-23(42)17-47-16-22/h2-4,11-14,20-23,25H,5-10,15-18H2,1H3,(H,44,45)/t20-,21+,22?,23?,25? |
| InChIKey | JLYYTEHILHAGBJ-CFKXAFPQSA-N |
| XLogP | 7.00 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.60 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |