About 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one
1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one (PubChem CID 170017964) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one |
| PubChem CID | 170017964 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one |
| SMILES | C=CC1=C(C)CN(C(=O)C(C)(C)O)CC1 |
| InChI | InChI=1S/C12H19NO2/c1-5-10-6-7-13(8-9(10)2)11(14)12(3,4)15/h5,15H,1,6-8H2,2-4H3 |
| InChIKey | WLKKZICNGMGHHN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one?
The IUPAC name of 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one (CID 170017964) is 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one.
What is the SMILES notation for 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one?
The canonical SMILES for 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one is C=CC1=C(C)CN(C(=O)C(C)(C)O)CC1.
What is the InChIKey of 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one?
The InChIKey is WLKKZICNGMGHHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-5-10-6-7-13(8-9(10)2)11(14)12(3,4)15/h5,15H,1,6-8H2,2-4H3.
What are the key properties of 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one?
1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one has a molecular weight of 209.29 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethenyl-5-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-hydroxy-2-methylpropan-1-one is sourced from PubChem (CID 170017964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).