C48H43N3 — CID 170018249
16,16,19,19-tetramethyl-12-[4-(3-naphthalen-2-yl-1,8a-dihydroquinoxalin-2-yl)phenyl]-12-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,7,9,13,15(20)-heptaene (PubChem CID 170018249) has the molecular formula C48H43N3 and a molecular weight of 661.89 g/mol. Its IUPAC name is 16,16,19,19-tetramethyl-12-[4-(3-naphthalen-2-yl-1,8a-dihydroquinoxalin-2-yl)phenyl]-12-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,7,9,13,15(20)-heptaene.
| Compound Name | 16,16,19,19-tetramethyl-12-[4-(3-naphthalen-2-yl-1,8a-dihydroquinoxalin-2-yl)phenyl]-12-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,7,9,13,15(20)-heptaene |
|---|---|
| PubChem CID | 170018249 |
| Molecular Formula | C48H43N3 |
| Molecular Weight | 661.89 g/mol |
| Exact Mass | 661.35 |
| IUPAC Name | 16,16,19,19-tetramethyl-12-[4-(3-naphthalen-2-yl-1,8a-dihydroquinoxalin-2-yl)phenyl]-12-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,7,9,13,15(20)-heptaene |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)c1cc2c(cc1n3-c1ccc(C3=C(c4ccc5ccccc5c4)N=C4C=CC=CC4N3)cc1)C=CCC2 |
| InChI | InChI=1S/C48H43N3/c1-47(2)23-24-48(3,4)40-29-44-38(28-39(40)47)37-26-33-13-7-8-14-34(33)27-43(37)51(44)36-21-19-31(20-22-36)45-46(50-42-16-10-9-15-41(42)49-45)35-18-17-30-11-5-6-12-32(30)25-35/h5-6,8-12,14-22,25-29,41,49H,7,13,23-24H2,1-4H3 |
| InChIKey | QZMFOKYQRJCPFQ-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.89 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|