C19H22S2 — CID 170018450
2,4,6-trimethyl-5-(5-methyl-2,3-dihydro-1H-inden-1-yl)benzene-1,3-dithiol (PubChem CID 170018450) has the molecular formula C19H22S2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 2,4,6-trimethyl-5-(5-methyl-2,3-dihydro-1H-inden-1-yl)benzene-1,3-dithiol.
| Compound Name | 2,4,6-trimethyl-5-(5-methyl-2,3-dihydro-1H-inden-1-yl)benzene-1,3-dithiol |
|---|---|
| PubChem CID | 170018450 |
| Molecular Formula | C19H22S2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2,4,6-trimethyl-5-(5-methyl-2,3-dihydro-1H-inden-1-yl)benzene-1,3-dithiol |
| SMILES | Cc1ccc2c(c1)CCC2c1c(C)c(S)c(C)c(S)c1C |
| InChI | InChI=1S/C19H22S2/c1-10-5-7-15-14(9-10)6-8-16(15)17-11(2)18(20)13(4)19(21)12(17)3/h5,7,9,16,20-21H,6,8H2,1-4H3 |
| InChIKey | QVVLVLGNIZWRQW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|