C38H34N4O3 — CID 170018632
2-[(2E)-2-[1-[2,6-di(propan-2-yl)phenyl]-6-methoxy-3-methylimidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 170018632) has the molecular formula C38H34N4O3 and a molecular weight of 594.72 g/mol. Its IUPAC name is 2-[(2E)-2-[1-[2,6-di(propan-2-yl)phenyl]-6-methoxy-3-methylimidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(2E)-2-[1-[2,6-di(propan-2-yl)phenyl]-6-methoxy-3-methylimidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 170018632 |
| Molecular Formula | C38H34N4O3 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | 2-[(2E)-2-[1-[2,6-di(propan-2-yl)phenyl]-6-methoxy-3-methylimidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | COc1ccc2nc3c(nc2c1)N(C)/C(=C\C=C1C(=O)c2cc4ccccc4cc2C1=O)N3c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C38H34N4O3/c1-21(2)26-12-9-13-27(22(3)4)34(26)42-33(41(5)37-38(42)39-31-16-14-25(45-6)20-32(31)40-37)17-15-28-35(43)29-18-23-10-7-8-11-24(23)19-30(29)36(28)44/h7-22H,1-6H3/b33-17+ |
| InChIKey | ZQOXADXXCMJZTD-ATZGPIRCSA-N |
| XLogP | 8.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|