C27H19N3OS — CID 170018759
2-[(2Z)-3-oxo-2-[(4,4,9-trimethylthieno[2,3-b]quinolin-2-yl)methylidene]inden-1-ylidene]propanedinitrile (PubChem CID 170018759) has the molecular formula C27H19N3OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-[(2Z)-3-oxo-2-[(4,4,9-trimethylthieno[2,3-b]quinolin-2-yl)methylidene]inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-3-oxo-2-[(4,4,9-trimethylthieno[2,3-b]quinolin-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170018759 |
| Molecular Formula | C27H19N3OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 2-[(2Z)-3-oxo-2-[(4,4,9-trimethylthieno[2,3-b]quinolin-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
| SMILES | CN1c2ccccc2C(C)(C)c2cc(/C=C3\C(=O)c4ccccc4C3=C(C#N)C#N)sc21 |
| InChI | InChI=1S/C27H19N3OS/c1-27(2)21-10-6-7-11-23(21)30(3)26-22(27)13-17(32-26)12-20-24(16(14-28)15-29)18-8-4-5-9-19(18)25(20)31/h4-13H,1-3H3/b20-12- |
| InChIKey | SYJVUDZEUMPJDH-NDENLUEZSA-N |
| XLogP | 6.24 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|