C45H46N4O2 — CID 170018829
(2E)-2-[2-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]-5-methylindene-1,3-dione (PubChem CID 170018829) has the molecular formula C45H46N4O2 and a molecular weight of 674.89 g/mol. Its IUPAC name is (2E)-2-[2-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]-5-methylindene-1,3-dione.
| Compound Name | (2E)-2-[2-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]-5-methylindene-1,3-dione |
|---|---|
| PubChem CID | 170018829 |
| Molecular Formula | C45H46N4O2 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | (2E)-2-[2-[1,3-bis[2,6-di(propan-2-yl)phenyl]imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]-5-methylindene-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)/C(=C/C=C1N(c3c(C(C)C)cccc3C(C)C)c3nc4ccccc4nc3N1c1c(C(C)C)cccc1C(C)C)C2=O |
| InChI | InChI=1S/C45H46N4O2/c1-25(2)30-14-12-15-31(26(3)4)40(30)48-39(23-22-35-42(50)34-21-20-29(9)24-36(34)43(35)51)49(41-32(27(5)6)16-13-17-33(41)28(7)8)45-44(48)46-37-18-10-11-19-38(37)47-45/h10-28H,1-9H3/b35-22+ |
| InChIKey | ASXKMVUTGYJTGX-FADJLKOXSA-N |
| XLogP | 11.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|