C23H21BrN2O — CID 17001892
2-(3-bromophenyl)-1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazole (PubChem CID 17001892) has the molecular formula C23H21BrN2O and a molecular weight of 421.34 g/mol. Its IUPAC name is 2-(3-bromophenyl)-1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazole.
| Compound Name | 2-(3-bromophenyl)-1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 17001892 |
| Molecular Formula | C23H21BrN2O |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2-(3-bromophenyl)-1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazole |
| SMILES | Cc1ccc(OCCn2c(-c3cccc(Br)c3)nc3ccccc32)cc1C |
| InChI | InChI=1S/C23H21BrN2O/c1-16-10-11-20(14-17(16)2)27-13-12-26-22-9-4-3-8-21(22)25-23(26)18-6-5-7-19(24)15-18/h3-11,14-15H,12-13H2,1-2H3 |
| InChIKey | GQIMBKBMNRUAKZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |