C18H25N — CID 170019410
4-[(1E,3Z)-4-ethyl-3,5-dimethyl-2-prop-1-en-2-ylhexa-1,3,5-trienyl]cyclopenta-1,3-dien-1-amine (PubChem CID 170019410) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is 4-[(1E,3Z)-4-ethyl-3,5-dimethyl-2-prop-1-en-2-ylhexa-1,3,5-trienyl]cyclopenta-1,3-dien-1-amine.
| Compound Name | 4-[(1E,3Z)-4-ethyl-3,5-dimethyl-2-prop-1-en-2-ylhexa-1,3,5-trienyl]cyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 170019410 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 4-[(1E,3Z)-4-ethyl-3,5-dimethyl-2-prop-1-en-2-ylhexa-1,3,5-trienyl]cyclopenta-1,3-dien-1-amine |
| SMILES | C=C(C)C(=C\C1=CC=C(N)C1)/C(C)=C(\CC)C(=C)C |
| InChI | InChI=1S/C18H25N/c1-7-17(12(2)3)14(6)18(13(4)5)11-15-8-9-16(19)10-15/h8-9,11H,2,4,7,10,19H2,1,3,5-6H3/b17-14-,18-11+ |
| InChIKey | CVLDPRJMTVTBTJ-GRMGBEPGSA-N |
| XLogP | 4.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|