C35H48N4 — CID 170019582
1-[4-cyclobutylidene-2-[(2E,4Z)-6-(2-ethyl-3,5-dimethylcyclopent-3-en-1-yl)hepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-N,N-dimethylpiperidin-4-amine (PubChem CID 170019582) has the molecular formula C35H48N4 and a molecular weight of 524.80 g/mol. Its IUPAC name is 1-[4-cyclobutylidene-2-[(2E,4Z)-6-(2-ethyl-3,5-dimethylcyclopent-3-en-1-yl)hepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[4-cyclobutylidene-2-[(2E,4Z)-6-(2-ethyl-3,5-dimethylcyclopent-3-en-1-yl)hepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 170019582 |
| Molecular Formula | C35H48N4 |
| Molecular Weight | 524.80 g/mol |
| Exact Mass | 524.39 |
| IUPAC Name | 1-[4-cyclobutylidene-2-[(2E,4Z)-6-(2-ethyl-3,5-dimethylcyclopent-3-en-1-yl)hepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-N,N-dimethylpiperidin-4-amine |
| SMILES | C=C(/C=C\C(=C/C)C1=CC(=C2CCC2)N2C=C(N3CCC(N(C)C)CC3)C=CC2=N1)C1C(C)C=C(C)C1CC |
| InChI | InChI=1S/C35H48N4/c1-8-27(14-13-24(3)35-26(5)21-25(4)31(35)9-2)32-22-33(28-11-10-12-28)39-23-30(15-16-34(39)36-32)38-19-17-29(18-20-38)37(6)7/h8,13-16,21-23,26,29,31,35H,3,9-12,17-20H2,1-2,4-7H3/b14-13-,27-8+ |
| InChIKey | JGHHAFZJVIDSET-JPLJLLHXSA-N |
| XLogP | 7.76 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.80 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|