C35H56N4 — CID 170019678
1-[(2E,4Z)-6-[(3Z,6E)-2-cyclobutylidene-7,8-dimethyl-5-methyliminonona-3,6,8-trien-4-yl]imino-7-methylnona-2,4-dien-3-yl]-N,N-diethylpiperidin-4-amine (PubChem CID 170019678) has the molecular formula C35H56N4 and a molecular weight of 532.86 g/mol. Its IUPAC name is 1-[(2E,4Z)-6-[(3Z,6E)-2-cyclobutylidene-7,8-dimethyl-5-methyliminonona-3,6,8-trien-4-yl]imino-7-methylnona-2,4-dien-3-yl]-N,N-diethylpiperidin-4-amine.
| Compound Name | 1-[(2E,4Z)-6-[(3Z,6E)-2-cyclobutylidene-7,8-dimethyl-5-methyliminonona-3,6,8-trien-4-yl]imino-7-methylnona-2,4-dien-3-yl]-N,N-diethylpiperidin-4-amine |
|---|---|
| PubChem CID | 170019678 |
| Molecular Formula | C35H56N4 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.45 |
| IUPAC Name | 1-[(2E,4Z)-6-[(3Z,6E)-2-cyclobutylidene-7,8-dimethyl-5-methyliminonona-3,6,8-trien-4-yl]imino-7-methylnona-2,4-dien-3-yl]-N,N-diethylpiperidin-4-amine |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C(=C/C(C)=C1CCC1)/N=C(\C=C/C(=C\C)N1CCC(N(CC)CC)CC1)C(C)CC |
| InChI | InChI=1S/C35H56N4/c1-11-27(7)33(19-18-31(12-2)39-22-20-32(21-23-39)38(13-3)14-4)37-35(25-29(9)30-16-15-17-30)34(36-10)24-28(8)26(5)6/h12,18-19,24-25,27,32H,5,11,13-17,20-23H2,1-4,6-10H3/b19-18-,28-24+,31-12+,35-25-,36-34+,37-33+ |
| InChIKey | CTSLTJWDRBTPCO-IUJNWJLCSA-N |
| XLogP | 8.72 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|