About 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol
2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol (PubChem CID 170020461) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol |
| PubChem CID | 170020461 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol |
| SMILES | CC1=CC=CC(C)(C(O)CN(C)C)C1 |
| InChI | InChI=1S/C12H21NO/c1-10-6-5-7-12(2,8-10)11(14)9-13(3)4/h5-7,11,14H,8-9H2,1-4H3 |
| InChIKey | YKGUXYMGDZMJTO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol?
The IUPAC name of 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol (CID 170020461) is 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol.
What is the SMILES notation for 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol?
The canonical SMILES for 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol is CC1=CC=CC(C)(C(O)CN(C)C)C1.
What is the InChIKey of 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol?
The InChIKey is YKGUXYMGDZMJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-10-6-5-7-12(2,8-10)11(14)9-13(3)4/h5-7,11,14H,8-9H2,1-4H3.
What are the key properties of 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol?
2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol has a molecular weight of 195.31 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-1-(1,5-dimethylcyclohexa-2,4-dien-1-yl)ethanol is sourced from PubChem (CID 170020461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).