C21H26N2 — CID 170020472
(2S,3S)-4-[[(2R,3R)-2,3-dimethyl-2,3-dihydro-1H-indol-5-yl]methyl]-2,3-dimethyl-2,3-dihydro-1H-indole (PubChem CID 170020472) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is (2S,3S)-4-[[(2R,3R)-2,3-dimethyl-2,3-dihydro-1H-indol-5-yl]methyl]-2,3-dimethyl-2,3-dihydro-1H-indole.
| Compound Name | (2S,3S)-4-[[(2R,3R)-2,3-dimethyl-2,3-dihydro-1H-indol-5-yl]methyl]-2,3-dimethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 170020472 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (2S,3S)-4-[[(2R,3R)-2,3-dimethyl-2,3-dihydro-1H-indol-5-yl]methyl]-2,3-dimethyl-2,3-dihydro-1H-indole |
| SMILES | C[C@@H]1Nc2cccc(Cc3ccc4c(c3)[C@@H](C)[C@@H](C)N4)c2[C@@H]1C |
| InChI | InChI=1S/C21H26N2/c1-12-14(3)22-19-9-8-16(11-18(12)19)10-17-6-5-7-20-21(17)13(2)15(4)23-20/h5-9,11-15,22-23H,10H2,1-4H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | IKDVHPQSKGCKOO-YJNKXOJESA-N |
| XLogP | 5.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |