C24H30N6OS — CID 170021227
3-amino-2-methyl-4-(methyliminomethyl)-6-[4-methyl-6-(3-methyl-3-methylsulfanylpiperazin-1-yl)quinazolin-2-yl]phenol (PubChem CID 170021227) has the molecular formula C24H30N6OS and a molecular weight of 450.61 g/mol. Its IUPAC name is 3-amino-2-methyl-4-(methyliminomethyl)-6-[4-methyl-6-(3-methyl-3-methylsulfanylpiperazin-1-yl)quinazolin-2-yl]phenol.
| Compound Name | 3-amino-2-methyl-4-(methyliminomethyl)-6-[4-methyl-6-(3-methyl-3-methylsulfanylpiperazin-1-yl)quinazolin-2-yl]phenol |
|---|---|
| PubChem CID | 170021227 |
| Molecular Formula | C24H30N6OS |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 3-amino-2-methyl-4-(methyliminomethyl)-6-[4-methyl-6-(3-methyl-3-methylsulfanylpiperazin-1-yl)quinazolin-2-yl]phenol |
| SMILES | C/N=C/c1cc(-c2nc(C)c3cc(N4CCNC(C)(SC)C4)ccc3n2)c(O)c(C)c1N |
| InChI | InChI=1S/C24H30N6OS/c1-14-21(25)16(12-26-4)10-19(22(14)31)23-28-15(2)18-11-17(6-7-20(18)29-23)30-9-8-27-24(3,13-30)32-5/h6-7,10-12,27,31H,8-9,13,25H2,1-5H3/b26-12+ |
| InChIKey | HEKSYHWBGBGPKD-RPPGKUMJSA-N |
| XLogP | 3.74 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|