C30H40N4 — CID 170021265
(E)-1-[4-cyclobutylidene-7-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine (PubChem CID 170021265) has the molecular formula C30H40N4 and a molecular weight of 456.68 g/mol. Its IUPAC name is (E)-1-[4-cyclobutylidene-7-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine.
| Compound Name | (E)-1-[4-cyclobutylidene-7-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
|---|---|
| PubChem CID | 170021265 |
| Molecular Formula | C30H40N4 |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | (E)-1-[4-cyclobutylidene-7-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)pyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethyl-4-methylidenehex-2-en-1-imine |
| SMILES | C=C(CC)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(C3=CC(C)(C)NC(C)(C)C3)C=CC2=N1 |
| InChI | InChI=1S/C30H40N4/c1-9-20(2)21(3)15-25(31-8)26-16-27(22-11-10-12-22)34-19-23(13-14-28(34)32-26)24-17-29(4,5)33-30(6,7)18-24/h13-17,19,33H,2,9-12,18H2,1,3-8H3/b21-15+,31-25+ |
| InChIKey | YSEWYNBHKKCCNL-ZJWVXYDPSA-N |
| XLogP | 6.94 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|