C33H54N2 — CID 170021584
N-[(1Z,3E)-1-[7-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]-3,4-dimethyl-4,5-dihydro-3H-azepin-2-yl]penta-1,3-dien-3-yl]-2-methyl-N-propylhexan-1-amine (PubChem CID 170021584) has the molecular formula C33H54N2 and a molecular weight of 478.81 g/mol. Its IUPAC name is N-[(1Z,3E)-1-[7-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]-3,4-dimethyl-4,5-dihydro-3H-azepin-2-yl]penta-1,3-dien-3-yl]-2-methyl-N-propylhexan-1-amine.
| Compound Name | N-[(1Z,3E)-1-[7-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]-3,4-dimethyl-4,5-dihydro-3H-azepin-2-yl]penta-1,3-dien-3-yl]-2-methyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 170021584 |
| Molecular Formula | C33H54N2 |
| Molecular Weight | 478.81 g/mol |
| Exact Mass | 478.43 |
| IUPAC Name | N-[(1Z,3E)-1-[7-[(2E,4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]-3,4-dimethyl-4,5-dihydro-3H-azepin-2-yl]penta-1,3-dien-3-yl]-2-methyl-N-propylhexan-1-amine |
| SMILES | C=C(C)/C(=C\C(=C/C)C1=CCC(C)C(C)C(/C=C\C(=C/C)N(CCC)CC(C)CCCC)=N1)CC |
| InChI | InChI=1S/C33H54N2/c1-11-16-17-26(8)24-35(22-12-2)31(15-5)19-21-32-28(10)27(9)18-20-33(34-32)30(14-4)23-29(13-3)25(6)7/h14-15,19-21,23,26-28H,6,11-13,16-18,22,24H2,1-5,7-10H3/b21-19-,29-23-,30-14+,31-15+ |
| InChIKey | UCBQVNSHDFRERM-ORCTWWQGSA-N |
| XLogP | 9.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.81 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|